About N'-methylcyclohexa-1,3-diene-1-carboximidamide
N'-methylcyclohexa-1,3-diene-1-carboximidamide (PubChem CID 137386436) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is N'-methylcyclohexa-1,3-diene-1-carboximidamide.
Molecular Properties
| Compound Name | N'-methylcyclohexa-1,3-diene-1-carboximidamide |
| PubChem CID | 137386436 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N'-methylcyclohexa-1,3-diene-1-carboximidamide |
| SMILES | C/N=C(\N)C1=CC=CCC1 |
| InChI | InChI=1S/C8H12N2/c1-10-8(9)7-5-3-2-4-6-7/h2-3,5H,4,6H2,1H3,(H2,9,10) |
| InChIKey | ZSLKYTZWMGGYGN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylcyclohexa-1,3-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylcyclohexa-1,3-diene-1-carboximidamide?
The IUPAC name of N'-methylcyclohexa-1,3-diene-1-carboximidamide (CID 137386436) is N'-methylcyclohexa-1,3-diene-1-carboximidamide.
What is the SMILES notation for N'-methylcyclohexa-1,3-diene-1-carboximidamide?
The canonical SMILES for N'-methylcyclohexa-1,3-diene-1-carboximidamide is C/N=C(\N)C1=CC=CCC1.
What is the InChIKey of N'-methylcyclohexa-1,3-diene-1-carboximidamide?
The InChIKey is ZSLKYTZWMGGYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-10-8(9)7-5-3-2-4-6-7/h2-3,5H,4,6H2,1H3,(H2,9,10).
What are the key properties of N'-methylcyclohexa-1,3-diene-1-carboximidamide?
N'-methylcyclohexa-1,3-diene-1-carboximidamide has a molecular weight of 136.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylcyclohexa-1,3-diene-1-carboximidamide is sourced from PubChem (CID 137386436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).