C17H21N3 — CID 137386480
2-cyclohepta-1,3,6-trien-1-yl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1,4-dihydro-1,3,5-triazine (PubChem CID 137386480) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-cyclohepta-1,3,6-trien-1-yl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-cyclohepta-1,3,6-trien-1-yl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 137386480 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-cyclohepta-1,3,6-trien-1-yl-4-[(2Z,4E)-hepta-2,4-dien-4-yl]-1,4-dihydro-1,3,5-triazine |
| SMILES | C/C=C\C(=C/CC)C1N=CNC(C2=CC=CCC=C2)=N1 |
| InChI | InChI=1S/C17H21N3/c1-3-9-14(10-4-2)16-18-13-19-17(20-16)15-11-7-5-6-8-12-15/h3,5,7-13,16H,4,6H2,1-2H3,(H,18,19,20)/b9-3-,14-10+ |
| InChIKey | UHVHWDWSRRERQF-HYFZIKBYSA-N |
| XLogP | 3.70 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|