About 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine
2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine (PubChem CID 137387877) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine.
Molecular Properties
| Compound Name | 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine |
| PubChem CID | 137387877 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine |
| SMILES | CCC(C)CC1=CC(F)NCC=C1 |
| InChI | InChI=1S/C11H18FN/c1-3-9(2)7-10-5-4-6-13-11(12)8-10/h4-5,8-9,11,13H,3,6-7H2,1-2H3 |
| InChIKey | KMVBYWSEULOUFM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine?
The IUPAC name of 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine (CID 137387877) is 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine.
What is the SMILES notation for 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine?
The canonical SMILES for 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine is CCC(C)CC1=CC(F)NCC=C1.
What is the InChIKey of 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine?
The InChIKey is KMVBYWSEULOUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN/c1-3-9(2)7-10-5-4-6-13-11(12)8-10/h4-5,8-9,11,13H,3,6-7H2,1-2H3.
What are the key properties of 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine?
2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine has a molecular weight of 183.27 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(2-methylbutyl)-2,7-dihydro-1H-azepine is sourced from PubChem (CID 137387877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).