C20H25N3O4S — CID 1373885
methyl 2-[(3-amino-4-methylbenzoyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 1373885) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is methyl 2-[(3-amino-4-methylbenzoyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-amino-4-methylbenzoyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1373885 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl 2-[(3-amino-4-methylbenzoyl)amino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=O)c2ccc(C)c(N)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C20H25N3O4S/c1-6-23(7-2)19(25)16-12(4)15(20(26)27-5)18(28-16)22-17(24)13-9-8-11(3)14(21)10-13/h8-10H,6-7,21H2,1-5H3,(H,22,24) |
| InChIKey | VFKWZPKOIHFVTM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|