C14H31NO4 — CID 137390115
1-amino-2,11-dimethyldodecane-3,5,7,9-tetrol (PubChem CID 137390115) has the molecular formula C14H31NO4 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-amino-2,11-dimethyldodecane-3,5,7,9-tetrol.
| Compound Name | 1-amino-2,11-dimethyldodecane-3,5,7,9-tetrol |
|---|---|
| PubChem CID | 137390115 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-amino-2,11-dimethyldodecane-3,5,7,9-tetrol |
| SMILES | CC(C)CC(O)CC(O)CC(O)CC(O)C(C)CN |
| InChI | InChI=1S/C14H31NO4/c1-9(2)4-11(16)5-12(17)6-13(18)7-14(19)10(3)8-15/h9-14,16-19H,4-8,15H2,1-3H3 |
| InChIKey | UHOMRZZGDBEZPL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |