About 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine
3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine (PubChem CID 137390242) has the molecular formula C17H14N4
and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine |
| PubChem CID | 137390242 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ncccc1/C=c1/c2ccccc2c2cncn12 |
| InChI | InChI=1S/C17H14N4/c1-18-17-12(5-4-8-20-17)9-15-13-6-2-3-7-14(13)16-10-19-11-21(15)16/h2-11H,1H3,(H,18,20)/b15-9- |
| InChIKey | DALWBGQMSZVZFJ-DHDCSXOGSA-N |
| XLogP | 2.47 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine?
The IUPAC name of 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine (CID 137390242) is 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine.
What is the SMILES notation for 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine?
The canonical SMILES for 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine is CNc1ncccc1/C=c1/c2ccccc2c2cncn12.
What is the InChIKey of 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine?
The InChIKey is DALWBGQMSZVZFJ-DHDCSXOGSA-N. The full InChI is InChI=1S/C17H14N4/c1-18-17-12(5-4-8-20-17)9-15-13-6-2-3-7-14(13)16-10-19-11-21(15)16/h2-11H,1H3,(H,18,20)/b15-9-.
What are the key properties of 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine?
3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine has a molecular weight of 274.33 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-imidazo[1,5-b]isoindol-5-ylidenemethyl]-N-methylpyridin-2-amine is sourced from PubChem (CID 137390242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).