About N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine
N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine (PubChem CID 137390441) has the molecular formula C13H26INO
and a molecular weight of 339.26 g/mol. Its IUPAC name is N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine.
Molecular Properties
| Compound Name | N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine |
| PubChem CID | 137390441 |
| Molecular Formula | C13H26INO |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine |
| SMILES | CC(C)C1OC1NC(C)(C)CC(C)(C)CI |
| InChI | InChI=1S/C13H26INO/c1-9(2)10-11(16-10)15-13(5,6)7-12(3,4)8-14/h9-11,15H,7-8H2,1-6H3 |
| InChIKey | LEVBFSXCJYYNPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine?
The IUPAC name of N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine (CID 137390441) is N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine.
What is the SMILES notation for N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine?
The canonical SMILES for N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine is CC(C)C1OC1NC(C)(C)CC(C)(C)CI.
What is the InChIKey of N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine?
The InChIKey is LEVBFSXCJYYNPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26INO/c1-9(2)10-11(16-10)15-13(5,6)7-12(3,4)8-14/h9-11,15H,7-8H2,1-6H3.
What are the key properties of N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine?
N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine has a molecular weight of 339.26 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-iodo-2,4,4-trimethylpentan-2-yl)-3-propan-2-yloxiran-2-amine is sourced from PubChem (CID 137390441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).