C26H17N5O2 — CID 137390461
2-[(E)-3-[5-[5-[5-[(1E)-4,4-dicyanobuta-1,3-dienyl]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile (PubChem CID 137390461) has the molecular formula C26H17N5O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-[(E)-3-[5-[5-[5-[(1E)-4,4-dicyanobuta-1,3-dienyl]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[5-[5-[5-[(1E)-4,4-dicyanobuta-1,3-dienyl]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 137390461 |
| Molecular Formula | C26H17N5O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[(E)-3-[5-[5-[5-[(1E)-4,4-dicyanobuta-1,3-dienyl]furan-2-yl]-1-ethylpyrrol-2-yl]furan-2-yl]prop-2-enylidene]propanedinitrile |
| SMILES | CCn1c(-c2ccc(/C=C/C=C(C#N)C#N)o2)ccc1-c1ccc(/C=C/C=C(C#N)C#N)o1 |
| InChI | InChI=1S/C26H17N5O2/c1-2-31-23(25-13-9-21(32-25)7-3-5-19(15-27)16-28)11-12-24(31)26-14-10-22(33-26)8-4-6-20(17-29)18-30/h3-14H,2H2,1H3/b7-3+,8-4+ |
| InChIKey | BDRJBDCEEOKOCF-FCXRPNKRSA-N |
| XLogP | 6.00 |
| TPSA | 126.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|