About 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine
4-(2,2-difluoro-3,3-dimethylbutyl)morpholine (PubChem CID 137390792) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine.
Molecular Properties
| Compound Name | 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine |
| PubChem CID | 137390792 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine |
| SMILES | CC(C)(C)C(F)(F)CN1CCOCC1 |
| InChI | InChI=1S/C10H19F2NO/c1-9(2,3)10(11,12)8-13-4-6-14-7-5-13/h4-8H2,1-3H3 |
| InChIKey | QZMMOBZCTAFBAU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine?
The IUPAC name of 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine (CID 137390792) is 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine.
What is the SMILES notation for 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine?
The canonical SMILES for 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine is CC(C)(C)C(F)(F)CN1CCOCC1.
What is the InChIKey of 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine?
The InChIKey is QZMMOBZCTAFBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-9(2,3)10(11,12)8-13-4-6-14-7-5-13/h4-8H2,1-3H3.
What are the key properties of 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine?
4-(2,2-difluoro-3,3-dimethylbutyl)morpholine has a molecular weight of 207.26 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoro-3,3-dimethylbutyl)morpholine is sourced from PubChem (CID 137390792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).