C12H23NS — CID 137390901
(2S)-1-(1-propan-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propane-2-thiol (PubChem CID 137390901) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is (2S)-1-(1-propan-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propane-2-thiol.
| Compound Name | (2S)-1-(1-propan-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propane-2-thiol |
|---|---|
| PubChem CID | 137390901 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (2S)-1-(1-propan-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propane-2-thiol |
| SMILES | CC(C)N1CCC=C(C[C@H](C)S)CC1 |
| InChI | InChI=1S/C12H23NS/c1-10(2)13-7-4-5-12(6-8-13)9-11(3)14/h5,10-11,14H,4,6-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | NUSZHAHZEQSHKI-NSHDSACASA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|