About 4,4-difluoro-1,3-di(propan-2-yl)piperidine
4,4-difluoro-1,3-di(propan-2-yl)piperidine (PubChem CID 137391659) has the molecular formula C11H21F2N
and a molecular weight of 205.29 g/mol. Its IUPAC name is 4,4-difluoro-1,3-di(propan-2-yl)piperidine.
Molecular Properties
| Compound Name | 4,4-difluoro-1,3-di(propan-2-yl)piperidine |
| PubChem CID | 137391659 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4,4-difluoro-1,3-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1CN(C(C)C)CCC1(F)F |
| InChI | InChI=1S/C11H21F2N/c1-8(2)10-7-14(9(3)4)6-5-11(10,12)13/h8-10H,5-7H2,1-4H3 |
| InChIKey | SALWUNKEZZWNFT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoro-1,3-di(propan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1,3-di(propan-2-yl)piperidine?
The IUPAC name of 4,4-difluoro-1,3-di(propan-2-yl)piperidine (CID 137391659) is 4,4-difluoro-1,3-di(propan-2-yl)piperidine.
What is the SMILES notation for 4,4-difluoro-1,3-di(propan-2-yl)piperidine?
The canonical SMILES for 4,4-difluoro-1,3-di(propan-2-yl)piperidine is CC(C)C1CN(C(C)C)CCC1(F)F.
What is the InChIKey of 4,4-difluoro-1,3-di(propan-2-yl)piperidine?
The InChIKey is SALWUNKEZZWNFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2N/c1-8(2)10-7-14(9(3)4)6-5-11(10,12)13/h8-10H,5-7H2,1-4H3.
What are the key properties of 4,4-difluoro-1,3-di(propan-2-yl)piperidine?
4,4-difluoro-1,3-di(propan-2-yl)piperidine has a molecular weight of 205.29 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1,3-di(propan-2-yl)piperidine is sourced from PubChem (CID 137391659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).