C27H39N — CID 137391903
(2Z,4E,6E,8E)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,7-dimethyl-9-(2,3,6,6-tetramethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 137391903) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,7-dimethyl-9-(2,3,6,6-tetramethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2Z,4E,6E,8E)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,7-dimethyl-9-(2,3,6,6-tetramethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 137391903 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | (2Z,4E,6E,8E)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,7-dimethyl-9-(2,3,6,6-tetramethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | C/C=C\C(=C/C)\N=C/C=C(C)\C=C\C=C(C)\C=C\C1=C(C)C(C)CCC1(C)C |
| InChI | InChI=1S/C27H39N/c1-9-12-25(10-2)28-20-18-22(4)14-11-13-21(3)15-16-26-24(6)23(5)17-19-27(26,7)8/h9-16,18,20,23H,17,19H2,1-8H3/b12-9-,14-11+,16-15+,21-13+,22-18-,25-10+,28-20+ |
| InChIKey | WTYHOEAWTDEMRX-GFILBICDSA-N |
| XLogP | 8.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|