C25H44N4O5S — CID 137392219
2-[6-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylhexanoyl-methylamino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide (PubChem CID 137392219) has the molecular formula C25H44N4O5S and a molecular weight of 512.72 g/mol. Its IUPAC name is 2-[6-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylhexanoyl-methylamino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide.
| Compound Name | 2-[6-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylhexanoyl-methylamino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 137392219 |
| Molecular Formula | C25H44N4O5S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[6-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylhexanoyl-methylamino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
| SMILES | CNCCNC(=O)C(CC(=O)C(C)(C)C)N(C)C(=O)CCCCCSC1CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C25H44N4O5S/c1-17(2)29-22(32)16-19(24(29)34)35-14-10-8-9-11-21(31)28(7)18(15-20(30)25(3,4)5)23(33)27-13-12-26-6/h17-19,26H,8-16H2,1-7H3,(H,27,33) |
| InChIKey | NEFMZTPYGIOIHQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|