C7H10F3IN2 — CID 137392388
[(2E,4E)-1,1,1-trifluoro-3-iodo-4-methylhexa-2,4-dien-2-yl]hydrazine (PubChem CID 137392388) has the molecular formula C7H10F3IN2 and a molecular weight of 306.07 g/mol. Its IUPAC name is [(2E,4E)-1,1,1-trifluoro-3-iodo-4-methylhexa-2,4-dien-2-yl]hydrazine.
| Compound Name | [(2E,4E)-1,1,1-trifluoro-3-iodo-4-methylhexa-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 137392388 |
| Molecular Formula | C7H10F3IN2 |
| Molecular Weight | 306.07 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | [(2E,4E)-1,1,1-trifluoro-3-iodo-4-methylhexa-2,4-dien-2-yl]hydrazine |
| SMILES | C/C=C(C)/C(I)=C(\NN)C(F)(F)F |
| InChI | InChI=1S/C7H10F3IN2/c1-3-4(2)5(11)6(13-12)7(8,9)10/h3,13H,12H2,1-2H3/b4-3+,6-5+ |
| InChIKey | AYQOQJOWYLQZIK-VNKDHWASSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|