C12H16O — CID 137393070
1-[(2E,4Z)-hexa-2,4-dien-2-yl]oxycyclohexa-1,3-diene (PubChem CID 137393070) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-2-yl]oxycyclohexa-1,3-diene.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]oxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 137393070 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-2-yl]oxycyclohexa-1,3-diene |
| SMILES | C/C=C\C=C(/C)OC1=CC=CCC1 |
| InChI | InChI=1S/C12H16O/c1-3-4-8-11(2)13-12-9-6-5-7-10-12/h3-6,8-9H,7,10H2,1-2H3/b4-3-,11-8+ |
| InChIKey | YGKCZRTWXQECCU-PRTWDDKSSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|