About 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide
4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide (PubChem CID 137394131) has the molecular formula C15H12N6OS
and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide |
| PubChem CID | 137394131 |
| Molecular Formula | C15H12N6OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide |
| SMILES | Cn1ccc(-c2[nH]c(C(N)=O)nc2-c2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C15H12N6OS/c1-21-5-4-10(20-21)13-12(18-15(19-13)14(16)22)8-2-3-9-11(6-8)23-7-17-9/h2-7H,1H3,(H2,16,22)(H,18,19) |
| InChIKey | OTSRYBQLSNIGHW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide?
The IUPAC name of 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide (CID 137394131) is 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide.
What is the SMILES notation for 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide?
The canonical SMILES for 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide is Cn1ccc(-c2[nH]c(C(N)=O)nc2-c2ccc3ncsc3c2)n1.
What is the InChIKey of 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide?
The InChIKey is OTSRYBQLSNIGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N6OS/c1-21-5-4-10(20-21)13-12(18-15(19-13)14(16)22)8-2-3-9-11(6-8)23-7-17-9/h2-7H,1H3,(H2,16,22)(H,18,19).
What are the key properties of 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide?
4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide has a molecular weight of 324.37 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-6-yl)-5-(1-methylpyrazol-3-yl)-1H-imidazole-2-carboxamide is sourced from PubChem (CID 137394131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).