C26H18F4N4 — CID 137394490
N-[(E)-[4-[3-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]-2,4-difluoroaniline (PubChem CID 137394490) has the molecular formula C26H18F4N4 and a molecular weight of 462.45 g/mol. Its IUPAC name is N-[(E)-[4-[3-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]-2,4-difluoroaniline.
| Compound Name | N-[(E)-[4-[3-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 137394490 |
| Molecular Formula | C26H18F4N4 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[(E)-[4-[3-[(E)-[(2,4-difluorophenyl)hydrazinylidene]methyl]phenyl]phenyl]methylideneamino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(N/N=C/c2ccc(-c3cccc(/C=N/Nc4ccc(F)cc4F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C26H18F4N4/c27-21-8-10-25(23(29)13-21)33-31-15-17-4-6-19(7-5-17)20-3-1-2-18(12-20)16-32-34-26-11-9-22(28)14-24(26)30/h1-16,33-34H/b31-15+,32-16+ |
| InChIKey | LAAOZBZXIFLDRK-IHXWQEJPSA-N |
| XLogP | 6.80 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|