C27H27FN4O6S2 — CID 137394748
2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenoxyethylamino)ethyl]acetamide (PubChem CID 137394748) has the molecular formula C27H27FN4O6S2 and a molecular weight of 586.67 g/mol. Its IUPAC name is 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenoxyethylamino)ethyl]acetamide.
| Compound Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenoxyethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 137394748 |
| Molecular Formula | C27H27FN4O6S2 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 2-[6-(6-fluoro-3-pyridinyl)-1,3-benzothiazol-2-yl]-2-(2-methoxyethylsulfonyl)-N-[2-oxo-2-(2-phenoxyethylamino)ethyl]acetamide |
| SMILES | COCCS(=O)(=O)C(C(=O)NCC(=O)NCCOc1ccccc1)c1nc2ccc(-c3ccc(F)nc3)cc2s1 |
| InChI | InChI=1S/C27H27FN4O6S2/c1-37-13-14-40(35,36)25(26(34)31-17-24(33)29-11-12-38-20-5-3-2-4-6-20)27-32-21-9-7-18(15-22(21)39-27)19-8-10-23(28)30-16-19/h2-10,15-16,25H,11-14,17H2,1H3,(H,29,33)(H,31,34) |
| InChIKey | FUNCGECTVUTIRL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|