C35H37NO4 — CID 137394852
(3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)piperidin-2-one (PubChem CID 137394852) has the molecular formula C35H37NO4 and a molecular weight of 535.68 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)piperidin-2-one.
| Compound Name | (3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)piperidin-2-one |
|---|---|
| PubChem CID | 137394852 |
| Molecular Formula | C35H37NO4 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(3-phenylpropyl)piperidin-2-one |
| SMILES | O=C1N[C@H](CCCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO4/c37-35-34(40-26-30-20-11-4-12-21-30)33(39-25-29-18-9-3-10-19-29)32(38-24-28-16-7-2-8-17-28)31(36-35)23-13-22-27-14-5-1-6-15-27/h1-12,14-21,31-34H,13,22-26H2,(H,36,37)/t31-,32-,33+,34+/m1/s1 |
| InChIKey | CWMMDJVAPYLHQJ-WZJLIZBTSA-N |
| XLogP | 6.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |