About 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid
3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid (PubChem CID 137394916) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid |
| PubChem CID | 137394916 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid |
| SMILES | O=C(O)CCO/C=C\C/C=C\O |
| InChI | InChI=1S/C8H12O4/c9-5-2-1-3-6-12-7-4-8(10)11/h2-3,5-6,9H,1,4,7H2,(H,10,11)/b5-2-,6-3- |
| InChIKey | MDCAPMLQZKBCCQ-SXUARNTMSA-N |
| XLogP | 1.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid?
The IUPAC name of 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid (CID 137394916) is 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid.
What is the SMILES notation for 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid?
The canonical SMILES for 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid is O=C(O)CCO/C=C\C/C=C\O.
What is the InChIKey of 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid?
The InChIKey is MDCAPMLQZKBCCQ-SXUARNTMSA-N. The full InChI is InChI=1S/C8H12O4/c9-5-2-1-3-6-12-7-4-8(10)11/h2-3,5-6,9H,1,4,7H2,(H,10,11)/b5-2-,6-3-.
What are the key properties of 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid?
3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid has a molecular weight of 172.18 g/mol, XLogP of 1.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z,4Z)-5-hydroxypenta-1,4-dienoxy]propanoic acid is sourced from PubChem (CID 137394916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).