About 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine
1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine (PubChem CID 137394943) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine |
| PubChem CID | 137394943 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine |
| SMILES | CNN/C=C(\C)C(C)C |
| InChI | InChI=1S/C7H16N2/c1-6(2)7(3)5-9-8-4/h5-6,8-9H,1-4H3/b7-5+ |
| InChIKey | KRQZGVNDKUIKQL-FNORWQNLSA-N |
| XLogP | 1.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine?
The IUPAC name of 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine (CID 137394943) is 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine.
What is the SMILES notation for 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine?
The canonical SMILES for 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine is CNN/C=C(\C)C(C)C.
What is the InChIKey of 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine?
The InChIKey is KRQZGVNDKUIKQL-FNORWQNLSA-N. The full InChI is InChI=1S/C7H16N2/c1-6(2)7(3)5-9-8-4/h5-6,8-9H,1-4H3/b7-5+.
What are the key properties of 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine?
1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine has a molecular weight of 128.22 g/mol, XLogP of 1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2,3-dimethylbut-1-enyl]-2-methylhydrazine is sourced from PubChem (CID 137394943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).