About 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene
4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene (PubChem CID 137395061) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene |
| PubChem CID | 137395061 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene |
| SMILES | CC1=CC=C(S(=O)(=O)C(C)C)CC1C |
| InChI | InChI=1S/C11H18O2S/c1-8(2)14(12,13)11-6-5-9(3)10(4)7-11/h5-6,8,10H,7H2,1-4H3 |
| InChIKey | CUTKVJMGHGWGSD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene?
The IUPAC name of 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene (CID 137395061) is 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene?
The canonical SMILES for 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene is CC1=CC=C(S(=O)(=O)C(C)C)CC1C.
What is the InChIKey of 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene?
The InChIKey is CUTKVJMGHGWGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c1-8(2)14(12,13)11-6-5-9(3)10(4)7-11/h5-6,8,10H,7H2,1-4H3.
What are the key properties of 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene?
4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene has a molecular weight of 214.33 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1-propan-2-ylsulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 137395061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).