About [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite
[2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite (PubChem CID 137395258) has the molecular formula C19H18INOS
and a molecular weight of 435.33 g/mol. Its IUPAC name is [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite |
| PubChem CID | 137395258 |
| Molecular Formula | C19H18INOS |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite |
| SMILES | COc1ccc([C@@H]2C[C@@H]2c2c(C)c3ccccc3n2SI)cc1 |
| InChI | InChI=1S/C19H18INOS/c1-12-15-5-3-4-6-18(15)21(23-20)19(12)17-11-16(17)13-7-9-14(22-2)10-8-13/h3-10,16-17H,11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | UEQLGFXXEAEIOB-IRXDYDNUSA-N |
| XLogP | 6.08 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite?
The IUPAC name of [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite (CID 137395258) is [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite.
What is the SMILES notation for [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite?
The canonical SMILES for [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite is COc1ccc([C@@H]2C[C@@H]2c2c(C)c3ccccc3n2SI)cc1.
What is the InChIKey of [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite?
The InChIKey is UEQLGFXXEAEIOB-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H18INOS/c1-12-15-5-3-4-6-18(15)21(23-20)19(12)17-11-16(17)13-7-9-14(22-2)10-8-13/h3-10,16-17H,11H2,1-2H3/t16-,17-/m0/s1.
What are the key properties of [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite?
[2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite has a molecular weight of 435.33 g/mol, XLogP of 6.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1S,2R)-2-(4-methoxyphenyl)cyclopropyl]-3-methylindol-1-yl] thiohypoiodite is sourced from PubChem (CID 137395258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).