C21H24N2O8 — CID 137395391
[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 2-methyl-3-[1-(2-methylpropanoyloxy)-2,5-dioxopyrrolidin-3-yl]propanoate (PubChem CID 137395391) has the molecular formula C21H24N2O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is [(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 2-methyl-3-[1-(2-methylpropanoyloxy)-2,5-dioxopyrrolidin-3-yl]propanoate.
| Compound Name | [(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 2-methyl-3-[1-(2-methylpropanoyloxy)-2,5-dioxopyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 137395391 |
| Molecular Formula | C21H24N2O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 2-methyl-3-[1-(2-methylpropanoyloxy)-2,5-dioxopyrrolidin-3-yl]propanoate |
| SMILES | CC(C)C(=O)ON1C(=O)CC(CC(C)C(=O)ON2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3C2)C1=O |
| InChI | InChI=1S/C21H24N2O8/c1-9(2)20(28)30-22-14(24)8-13(17(22)25)6-10(3)21(29)31-23-18(26)15-11-4-5-12(7-11)16(15)19(23)27/h4-5,9-13,15-16H,6-8H2,1-3H3/t10?,11-,12+,13?,15-,16+ |
| InChIKey | VYKVBXZRPVLQQE-NKZIJUFSSA-N |
| XLogP | 0.77 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|