About 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol
2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol (PubChem CID 137395556) has the molecular formula C17H19NS
and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol |
| PubChem CID | 137395556 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol |
| SMILES | CC1(C)c2ccccc2Nc2ccc(CCS)cc21 |
| InChI | InChI=1S/C17H19NS/c1-17(2)13-5-3-4-6-15(13)18-16-8-7-12(9-10-19)11-14(16)17/h3-8,11,18-19H,9-10H2,1-2H3 |
| InChIKey | UNJAZAIPLUUKGD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol?
The IUPAC name of 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol (CID 137395556) is 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol.
What is the SMILES notation for 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol?
The canonical SMILES for 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol is CC1(C)c2ccccc2Nc2ccc(CCS)cc21.
What is the InChIKey of 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol?
The InChIKey is UNJAZAIPLUUKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NS/c1-17(2)13-5-3-4-6-15(13)18-16-8-7-12(9-10-19)11-14(16)17/h3-8,11,18-19H,9-10H2,1-2H3.
What are the key properties of 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol?
2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol has a molecular weight of 269.41 g/mol, XLogP of 4.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9,9-dimethyl-10H-acridin-2-yl)ethanethiol is sourced from PubChem (CID 137395556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).