About N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine
N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine (PubChem CID 137396264) has the molecular formula C16H35N3O
and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine |
| PubChem CID | 137396264 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CCNC1CCN(CCOC)CC1 |
| InChI | InChI=1S/C16H35N3O/c1-4-9-18(10-5-2)13-8-17-16-6-11-19(12-7-16)14-15-20-3/h16-17H,4-15H2,1-3H3 |
| InChIKey | IPQHWCGQCBOBRH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine?
The IUPAC name of N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine (CID 137396264) is N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine.
What is the SMILES notation for N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine?
The canonical SMILES for N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine is CCCN(CCC)CCNC1CCN(CCOC)CC1.
What is the InChIKey of N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine?
The InChIKey is IPQHWCGQCBOBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N3O/c1-4-9-18(10-5-2)13-8-17-16-6-11-19(12-7-16)14-15-20-3/h16-17H,4-15H2,1-3H3.
What are the key properties of N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine?
N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine has a molecular weight of 285.48 g/mol, XLogP of 1.81, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-methoxyethyl)piperidin-4-yl]-N',N'-dipropylethane-1,2-diamine is sourced from PubChem (CID 137396264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).