About 6-(2-methylpropyl)-6,7-dihydrocinnoline
6-(2-methylpropyl)-6,7-dihydrocinnoline (PubChem CID 137396266) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-(2-methylpropyl)-6,7-dihydrocinnoline.
Molecular Properties
| Compound Name | 6-(2-methylpropyl)-6,7-dihydrocinnoline |
| PubChem CID | 137396266 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6-(2-methylpropyl)-6,7-dihydrocinnoline |
| SMILES | CC(C)CC1C=c2ccnnc2=CC1 |
| InChI | InChI=1S/C12H16N2/c1-9(2)7-10-3-4-12-11(8-10)5-6-13-14-12/h4-6,8-10H,3,7H2,1-2H3 |
| InChIKey | VHJNBTSTCVKWIJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-methylpropyl)-6,7-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropyl)-6,7-dihydrocinnoline?
The IUPAC name of 6-(2-methylpropyl)-6,7-dihydrocinnoline (CID 137396266) is 6-(2-methylpropyl)-6,7-dihydrocinnoline.
What is the SMILES notation for 6-(2-methylpropyl)-6,7-dihydrocinnoline?
The canonical SMILES for 6-(2-methylpropyl)-6,7-dihydrocinnoline is CC(C)CC1C=c2ccnnc2=CC1.
What is the InChIKey of 6-(2-methylpropyl)-6,7-dihydrocinnoline?
The InChIKey is VHJNBTSTCVKWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-9(2)7-10-3-4-12-11(8-10)5-6-13-14-12/h4-6,8-10H,3,7H2,1-2H3.
What are the key properties of 6-(2-methylpropyl)-6,7-dihydrocinnoline?
6-(2-methylpropyl)-6,7-dihydrocinnoline has a molecular weight of 188.27 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropyl)-6,7-dihydrocinnoline is sourced from PubChem (CID 137396266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).