C16H16F4N2O3S — CID 137396296
3-ethylsulfonyl-2-[5-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]pyridine (PubChem CID 137396296) has the molecular formula C16H16F4N2O3S and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[5-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]pyridine.
| Compound Name | 3-ethylsulfonyl-2-[5-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 137396296 |
| Molecular Formula | C16H16F4N2O3S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-ethylsulfonyl-2-[5-(2,2,3,3-tetrafluoropropoxymethyl)-2-pyridinyl]pyridine |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(COCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C16H16F4N2O3S/c1-2-26(23,24)13-4-3-7-21-14(13)12-6-5-11(8-22-12)9-25-10-16(19,20)15(17)18/h3-8,15H,2,9-10H2,1H3 |
| InChIKey | FGFFBKJFPRCXQZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|