C16H19N5 — CID 137396683
(1R,9S,12R)-4,12-dimethyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 137396683) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is (1R,9S,12R)-4,12-dimethyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | (1R,9S,12R)-4,12-dimethyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 137396683 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (1R,9S,12R)-4,12-dimethyl-6-pyrazin-2-yl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | Cc1nc(-c2cnccn2)c2c(n1)[C@@H]1N[C@@H](CC[C@H]1C)C2 |
| InChI | InChI=1S/C16H19N5/c1-9-3-4-11-7-12-15(13-8-17-5-6-18-13)19-10(2)20-16(12)14(9)21-11/h5-6,8-9,11,14,21H,3-4,7H2,1-2H3/t9-,11+,14-/m1/s1 |
| InChIKey | VTKAOGXBHDCWPA-OLUVUFQESA-N |
| XLogP | 2.23 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |