C14H13N7OS — CID 137397002
2,9-dimethyl-13-(1H-pyrazol-5-ylamino)-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (PubChem CID 137397002) has the molecular formula C14H13N7OS and a molecular weight of 327.37 g/mol. Its IUPAC name is 2,9-dimethyl-13-(1H-pyrazol-5-ylamino)-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one.
| Compound Name | 2,9-dimethyl-13-(1H-pyrazol-5-ylamino)-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 137397002 |
| Molecular Formula | C14H13N7OS |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2,9-dimethyl-13-(1H-pyrazol-5-ylamino)-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| SMILES | CN1C(=O)c2sccc2N(C)c2nc(Nc3ccn[nH]3)ncc21 |
| InChI | InChI=1S/C14H13N7OS/c1-20-8-4-6-23-11(8)13(22)21(2)9-7-15-14(18-12(9)20)17-10-3-5-16-19-10/h3-7H,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | WEKLTYNUFLHJRX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |