C20H18N6O3S — CID 137397004
4-[(8-methyl-9-oxo-1,3,5,8-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-4-yl)amino]benzenesulfonamide (PubChem CID 137397004) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is 4-[(8-methyl-9-oxo-1,3,5,8-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(8-methyl-9-oxo-1,3,5,8-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 137397004 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 4-[(8-methyl-9-oxo-1,3,5,8-tetrazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-4-yl)amino]benzenesulfonamide |
| SMILES | CN1C(=O)c2cccc3c2N(CC3)c2nc(Nc3ccc(S(N)(=O)=O)cc3)ncc21 |
| InChI | InChI=1S/C20H18N6O3S/c1-25-16-11-22-20(23-13-5-7-14(8-6-13)30(21,28)29)24-18(16)26-10-9-12-3-2-4-15(17(12)26)19(25)27/h2-8,11H,9-10H2,1H3,(H2,21,28,29)(H,22,23,24) |
| InChIKey | DXGQKECDXIUGEE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |