About 3,4-dihydro-2H-thieno[3,2-c]azepine
3,4-dihydro-2H-thieno[3,2-c]azepine (PubChem CID 137397439) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-thieno[3,2-c]azepine.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-thieno[3,2-c]azepine |
| PubChem CID | 137397439 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 3,4-dihydro-2H-thieno[3,2-c]azepine |
| SMILES | C1=CC2=C(CCS2)CN=C1 |
| InChI | InChI=1S/C8H9NS/c1-2-8-7(3-5-10-8)6-9-4-1/h1-2,4H,3,5-6H2 |
| InChIKey | NVLMKOUZCJQMPP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-thieno[3,2-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-thieno[3,2-c]azepine?
The IUPAC name of 3,4-dihydro-2H-thieno[3,2-c]azepine (CID 137397439) is 3,4-dihydro-2H-thieno[3,2-c]azepine.
What is the SMILES notation for 3,4-dihydro-2H-thieno[3,2-c]azepine?
The canonical SMILES for 3,4-dihydro-2H-thieno[3,2-c]azepine is C1=CC2=C(CCS2)CN=C1.
What is the InChIKey of 3,4-dihydro-2H-thieno[3,2-c]azepine?
The InChIKey is NVLMKOUZCJQMPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c1-2-8-7(3-5-10-8)6-9-4-1/h1-2,4H,3,5-6H2.
What are the key properties of 3,4-dihydro-2H-thieno[3,2-c]azepine?
3,4-dihydro-2H-thieno[3,2-c]azepine has a molecular weight of 151.23 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-thieno[3,2-c]azepine is sourced from PubChem (CID 137397439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).