C18H33N3O3 — CID 137397596
1-hydroxy-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,5,5-tetramethylpyrrole-3-carboxamide (PubChem CID 137397596) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-hydroxy-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,5,5-tetramethylpyrrole-3-carboxamide.
| Compound Name | 1-hydroxy-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,5,5-tetramethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 137397596 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 1-hydroxy-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-2,2,5,5-tetramethylpyrrole-3-carboxamide |
| SMILES | CC1(C)C=C(C(=O)NC2CC(C)(C)N(O)C(C)(C)C2)C(C)(C)N1O |
| InChI | InChI=1S/C18H33N3O3/c1-15(2)9-12(10-16(3,4)20(15)23)19-14(22)13-11-17(5,6)21(24)18(13,7)8/h11-12,23-24H,9-10H2,1-8H3,(H,19,22) |
| InChIKey | QAPMNTFNEAJQNH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |