C33H39N5O7 — CID 137397961
4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 137397961) has the molecular formula C33H39N5O7 and a molecular weight of 617.70 g/mol. Its IUPAC name is 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 137397961 |
| Molecular Formula | C33H39N5O7 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | CN1C(=O)C2c3c(n(Cc4ccc(C(=O)NOC5CCCCO5)cc4)c4ccc(OCCN5CCOCC5)cc34)CCN2C1=O |
| InChI | InChI=1S/C33H39N5O7/c1-35-32(40)30-29-25-20-24(43-19-15-36-13-17-42-18-14-36)9-10-26(25)38(27(29)11-12-37(30)33(35)41)21-22-5-7-23(8-6-22)31(39)34-45-28-4-2-3-16-44-28/h5-10,20,28,30H,2-4,11-19,21H2,1H3,(H,34,39) |
| InChIKey | LOTMFWPVHDZGKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|