C32H38N4O6 — CID 137397964
butyl 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate (PubChem CID 137397964) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is butyl 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate.
| Compound Name | butyl 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate |
|---|---|
| PubChem CID | 137397964 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | butyl 4-[[4-methyl-14-(2-morpholin-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(Cn2c3c(c4cc(OCCN5CCOCC5)ccc42)C2C(=O)N(C)C(=O)N2CC3)cc1 |
| InChI | InChI=1S/C32H38N4O6/c1-3-4-16-42-31(38)23-7-5-22(6-8-23)21-36-26-10-9-24(41-19-15-34-13-17-40-18-14-34)20-25(26)28-27(36)11-12-35-29(28)30(37)33(2)32(35)39/h5-10,20,29H,3-4,11-19,21H2,1-2H3 |
| InChIKey | HNYGOEFFVJOMFV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|