About 3-ethenyl-3,8-dimethylnonan-2-imine
3-ethenyl-3,8-dimethylnonan-2-imine (PubChem CID 137398067) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 3-ethenyl-3,8-dimethylnonan-2-imine.
Molecular Properties
| Compound Name | 3-ethenyl-3,8-dimethylnonan-2-imine |
| PubChem CID | 137398067 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3-ethenyl-3,8-dimethylnonan-2-imine |
| SMILES | [H]/N=C(\C)C(C)(C=C)CCCCC(C)C |
| InChI | InChI=1S/C13H25N/c1-6-13(5,12(4)14)10-8-7-9-11(2)3/h6,11,14H,1,7-10H2,2-5H3/b14-12+ |
| InChIKey | PHYPYKMWDOWHPR-WYMLVPIESA-N |
| XLogP | 4.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-3,8-dimethylnonan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-3,8-dimethylnonan-2-imine?
The IUPAC name of 3-ethenyl-3,8-dimethylnonan-2-imine (CID 137398067) is 3-ethenyl-3,8-dimethylnonan-2-imine.
What is the SMILES notation for 3-ethenyl-3,8-dimethylnonan-2-imine?
The canonical SMILES for 3-ethenyl-3,8-dimethylnonan-2-imine is [H]/N=C(\C)C(C)(C=C)CCCCC(C)C.
What is the InChIKey of 3-ethenyl-3,8-dimethylnonan-2-imine?
The InChIKey is PHYPYKMWDOWHPR-WYMLVPIESA-N. The full InChI is InChI=1S/C13H25N/c1-6-13(5,12(4)14)10-8-7-9-11(2)3/h6,11,14H,1,7-10H2,2-5H3/b14-12+.
What are the key properties of 3-ethenyl-3,8-dimethylnonan-2-imine?
3-ethenyl-3,8-dimethylnonan-2-imine has a molecular weight of 195.35 g/mol, XLogP of 4.43, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-3,8-dimethylnonan-2-imine is sourced from PubChem (CID 137398067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).