C35H48Cl2N4O6 — CID 137398319
tert-butyl (2S,3S,4R)-4-(3,7-dichloroquinoxalin-2-yl)oxy-1-[(2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoyl]-3-methylpyrrolidine-2-carboxylate (PubChem CID 137398319) has the molecular formula C35H48Cl2N4O6 and a molecular weight of 691.70 g/mol. Its IUPAC name is tert-butyl (2S,3S,4R)-4-(3,7-dichloroquinoxalin-2-yl)oxy-1-[(2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoyl]-3-methylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3S,4R)-4-(3,7-dichloroquinoxalin-2-yl)oxy-1-[(2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoyl]-3-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 137398319 |
| Molecular Formula | C35H48Cl2N4O6 |
| Molecular Weight | 691.70 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | tert-butyl (2S,3S,4R)-4-(3,7-dichloroquinoxalin-2-yl)oxy-1-[(2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoyl]-3-methylpyrrolidine-2-carboxylate |
| SMILES | C=CCCC[C@@H]1CCC[C@H]1OC(=O)N[C@H](C(=O)N1C[C@H](Oc2nc3cc(Cl)ccc3nc2Cl)[C@@H](C)[C@H]1C(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C35H48Cl2N4O6/c1-9-10-11-13-21-14-12-15-25(21)46-33(44)40-28(34(3,4)5)31(42)41-19-26(20(2)27(41)32(43)47-35(6,7)8)45-30-29(37)38-23-17-16-22(36)18-24(23)39-30/h9,16-18,20-21,25-28H,1,10-15,19H2,2-8H3,(H,40,44)/t20-,21-,25-,26+,27+,28-/m1/s1 |
| InChIKey | JSNBFTXKVDJXKH-XEHFQQOVSA-N |
| XLogP | 7.54 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|