About 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid
2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid (PubChem CID 137398593) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid |
| PubChem CID | 137398593 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid |
| SMILES | C=C(/C=C(\CC)C(=O)O)c1sccc1C(=O)O |
| InChI | InChI=1S/C12H12O4S/c1-3-8(11(13)14)6-7(2)10-9(12(15)16)4-5-17-10/h4-6H,2-3H2,1H3,(H,13,14)(H,15,16)/b8-6+ |
| InChIKey | DRZJTTWAUPWUNG-SOFGYWHQSA-N |
| XLogP | 2.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid?
The IUPAC name of 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid (CID 137398593) is 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid.
What is the SMILES notation for 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid?
The canonical SMILES for 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid is C=C(/C=C(\CC)C(=O)O)c1sccc1C(=O)O.
What is the InChIKey of 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid?
The InChIKey is DRZJTTWAUPWUNG-SOFGYWHQSA-N. The full InChI is InChI=1S/C12H12O4S/c1-3-8(11(13)14)6-7(2)10-9(12(15)16)4-5-17-10/h4-6H,2-3H2,1H3,(H,13,14)(H,15,16)/b8-6+.
What are the key properties of 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid?
2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid has a molecular weight of 252.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-4-carboxyhexa-1,3-dien-2-yl]thiophene-3-carboxylic acid is sourced from PubChem (CID 137398593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).