About 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine
3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine (PubChem CID 137398651) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine.
Molecular Properties
| Compound Name | 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine |
| PubChem CID | 137398651 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine |
| SMILES | [H]/N=C(\C)C(C)(CC1CCCCC1)C(=C)C |
| InChI | InChI=1S/C14H25N/c1-11(2)14(4,12(3)15)10-13-8-6-5-7-9-13/h13,15H,1,5-10H2,2-4H3/b15-12+ |
| InChIKey | UOWOVVWLHMMZAY-NTCAYCPXSA-N |
| XLogP | 4.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine?
The IUPAC name of 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine (CID 137398651) is 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine.
What is the SMILES notation for 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine?
The canonical SMILES for 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine is [H]/N=C(\C)C(C)(CC1CCCCC1)C(=C)C.
What is the InChIKey of 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine?
The InChIKey is UOWOVVWLHMMZAY-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H25N/c1-11(2)14(4,12(3)15)10-13-8-6-5-7-9-13/h13,15H,1,5-10H2,2-4H3/b15-12+.
What are the key properties of 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine?
3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine has a molecular weight of 207.36 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylmethyl)-3,4-dimethylpent-4-en-2-imine is sourced from PubChem (CID 137398651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).