C31H37ClN2O4S — CID 137398754
(9'Z)-7-chloro-7'-hydroxy-12'-methyl-13'-oxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-9,16(25),17,19(24)-tetraene]-15'-one (PubChem CID 137398754) has the molecular formula C31H37ClN2O4S and a molecular weight of 569.17 g/mol. Its IUPAC name is (9'Z)-7-chloro-7'-hydroxy-12'-methyl-13'-oxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-9,16(25),17,19(24)-tetraene]-15'-one.
| Compound Name | (9'Z)-7-chloro-7'-hydroxy-12'-methyl-13'-oxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-9,16(25),17,19(24)-tetraene]-15'-one |
|---|---|
| PubChem CID | 137398754 |
| Molecular Formula | C31H37ClN2O4S |
| Molecular Weight | 569.17 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (9'Z)-7-chloro-7'-hydroxy-12'-methyl-13'-oxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-9,16(25),17,19(24)-tetraene]-15'-one |
| SMILES | CC1C/C=C\CC(O)C2CCC2CN2CC3(CCCc4cc(Cl)ccc43)COc3ccc(cc32)C(=O)NS1=O |
| InChI | InChI=1S/C31H37ClN2O4S/c1-20-5-2-3-7-28(35)25-11-8-23(25)17-34-18-31(14-4-6-21-15-24(32)10-12-26(21)31)19-38-29-13-9-22(16-27(29)34)30(36)33-39(20)37/h2-3,9-10,12-13,15-16,20,23,25,28,35H,4-8,11,14,17-19H2,1H3,(H,33,36)/b3-2- |
| InChIKey | VLCUJCKWCOMOPA-IHWYPQMZSA-N |
| XLogP | 5.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.17 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|