About 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole
5,6-difluoro-4-methyl-2,1,3-benzothiadiazole (PubChem CID 137399229) has the molecular formula C7H4F2N2S
and a molecular weight of 186.19 g/mol. Its IUPAC name is 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole |
| PubChem CID | 137399229 |
| Molecular Formula | C7H4F2N2S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole |
| SMILES | Cc1c(F)c(F)cc2nsnc12 |
| InChI | InChI=1S/C7H4F2N2S/c1-3-6(9)4(8)2-5-7(3)11-12-10-5/h2H,1H3 |
| InChIKey | RGTHEPXTVGOXFL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole?
The IUPAC name of 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole (CID 137399229) is 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole?
The canonical SMILES for 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole is Cc1c(F)c(F)cc2nsnc12.
What is the InChIKey of 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole?
The InChIKey is RGTHEPXTVGOXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2N2S/c1-3-6(9)4(8)2-5-7(3)11-12-10-5/h2H,1H3.
What are the key properties of 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole?
5,6-difluoro-4-methyl-2,1,3-benzothiadiazole has a molecular weight of 186.19 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-4-methyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 137399229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).