About 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole
1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole (PubChem CID 137399517) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole.
Molecular Properties
| Compound Name | 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole |
| PubChem CID | 137399517 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole |
| SMILES | On1ccc2c1CCC2 |
| InChI | InChI=1S/C7H9NO/c9-8-5-4-6-2-1-3-7(6)8/h4-5,9H,1-3H2 |
| InChIKey | GZEFOVOWJXDWBF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The IUPAC name of 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole (CID 137399517) is 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole.
What is the SMILES notation for 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The canonical SMILES for 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole is On1ccc2c1CCC2.
What is the InChIKey of 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The InChIKey is GZEFOVOWJXDWBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c9-8-5-4-6-2-1-3-7(6)8/h4-5,9H,1-3H2.
What are the key properties of 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole?
1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole has a molecular weight of 123.15 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-5,6-dihydro-4H-cyclopenta[b]pyrrole is sourced from PubChem (CID 137399517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).