About 2-(hydroxymethyl)piperidine-3,4,5-triol
2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 1374) has the molecular formula C6H13NO4
and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-(hydroxymethyl)piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)piperidine-3,4,5-triol |
| PubChem CID | 1374 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OCC1NCC(O)C(O)C1O |
| InChI | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2 |
| InChIKey | LXBIFEVIBLOUGU-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)piperidine-3,4,5-triol?
The IUPAC name of 2-(hydroxymethyl)piperidine-3,4,5-triol (CID 1374) is 2-(hydroxymethyl)piperidine-3,4,5-triol.
What is the SMILES notation for 2-(hydroxymethyl)piperidine-3,4,5-triol?
The canonical SMILES for 2-(hydroxymethyl)piperidine-3,4,5-triol is OCC1NCC(O)C(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)piperidine-3,4,5-triol?
The InChIKey is LXBIFEVIBLOUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2.
What are the key properties of 2-(hydroxymethyl)piperidine-3,4,5-triol?
2-(hydroxymethyl)piperidine-3,4,5-triol has a molecular weight of 163.17 g/mol, XLogP of -2.97, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)piperidine-3,4,5-triol is sourced from PubChem (CID 1374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).