About 2-thieno[2,3-d]pyrimidin-2-ylethanol
2-thieno[2,3-d]pyrimidin-2-ylethanol (PubChem CID 137400060) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-thieno[2,3-d]pyrimidin-2-ylethanol.
Molecular Properties
| Compound Name | 2-thieno[2,3-d]pyrimidin-2-ylethanol |
| PubChem CID | 137400060 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-thieno[2,3-d]pyrimidin-2-ylethanol |
| SMILES | OCCc1ncc2ccsc2n1 |
| InChI | InChI=1S/C8H8N2OS/c11-3-1-7-9-5-6-2-4-12-8(6)10-7/h2,4-5,11H,1,3H2 |
| InChIKey | TUDONJFFGOQPQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-thieno[2,3-d]pyrimidin-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[2,3-d]pyrimidin-2-ylethanol?
The IUPAC name of 2-thieno[2,3-d]pyrimidin-2-ylethanol (CID 137400060) is 2-thieno[2,3-d]pyrimidin-2-ylethanol.
What is the SMILES notation for 2-thieno[2,3-d]pyrimidin-2-ylethanol?
The canonical SMILES for 2-thieno[2,3-d]pyrimidin-2-ylethanol is OCCc1ncc2ccsc2n1.
What is the InChIKey of 2-thieno[2,3-d]pyrimidin-2-ylethanol?
The InChIKey is TUDONJFFGOQPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c11-3-1-7-9-5-6-2-4-12-8(6)10-7/h2,4-5,11H,1,3H2.
What are the key properties of 2-thieno[2,3-d]pyrimidin-2-ylethanol?
2-thieno[2,3-d]pyrimidin-2-ylethanol has a molecular weight of 180.23 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[2,3-d]pyrimidin-2-ylethanol is sourced from PubChem (CID 137400060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).