C16H27F2N — CID 137400808
2-[(E)-7,7-difluoro-5-methylhept-2-en-3-yl]-3,5,6-trimethyl-1,2,3,4-tetrahydropyridine (PubChem CID 137400808) has the molecular formula C16H27F2N and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-[(E)-7,7-difluoro-5-methylhept-2-en-3-yl]-3,5,6-trimethyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 2-[(E)-7,7-difluoro-5-methylhept-2-en-3-yl]-3,5,6-trimethyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 137400808 |
| Molecular Formula | C16H27F2N |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2-[(E)-7,7-difluoro-5-methylhept-2-en-3-yl]-3,5,6-trimethyl-1,2,3,4-tetrahydropyridine |
| SMILES | C/C=C(\CC(C)CC(F)F)C1NC(C)=C(C)CC1C |
| InChI | InChI=1S/C16H27F2N/c1-6-14(7-10(2)8-15(17)18)16-12(4)9-11(3)13(5)19-16/h6,10,12,15-16,19H,7-9H2,1-5H3/b14-6+ |
| InChIKey | QGTUHBUQTCIDEM-MKMNVTDBSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|