About N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine
N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine (PubChem CID 137400886) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine.
Molecular Properties
| Compound Name | N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine |
| PubChem CID | 137400886 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine |
| SMILES | CCCCN(CC)C1=C(C)N=CC(C2=C(C)N=C2C)C=C1 |
| InChI | InChI=1S/C18H27N3/c1-6-8-11-21(7-2)17-10-9-16(12-19-13(17)3)18-14(4)20-15(18)5/h9-10,12,16H,6-8,11H2,1-5H3 |
| InChIKey | JQLINCUUYPRNFA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine?
The IUPAC name of N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine (CID 137400886) is N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine.
What is the SMILES notation for N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine?
The canonical SMILES for N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine is CCCCN(CC)C1=C(C)N=CC(C2=C(C)N=C2C)C=C1.
What is the InChIKey of N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine?
The InChIKey is JQLINCUUYPRNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3/c1-6-8-11-21(7-2)17-10-9-16(12-19-13(17)3)18-14(4)20-15(18)5/h9-10,12,16H,6-8,11H2,1-5H3.
What are the key properties of N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine?
N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine has a molecular weight of 285.44 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-3-(2,4-dimethylazet-3-yl)-N-ethyl-7-methyl-3H-azepin-6-amine is sourced from PubChem (CID 137400886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).