C34H45FN6 — CID 137401013
2-cyclohexyl-6-ethyl-N-[1-[10-[3-(2-fluoropropan-2-yl)phenyl]-2-methyl-2,7,9-triazabicyclo[6.5.0]trideca-1(13),8,10-trien-7-yl]ethenyl]pyrimidin-4-amine (PubChem CID 137401013) has the molecular formula C34H45FN6 and a molecular weight of 556.77 g/mol. Its IUPAC name is 2-cyclohexyl-6-ethyl-N-[1-[10-[3-(2-fluoropropan-2-yl)phenyl]-2-methyl-2,7,9-triazabicyclo[6.5.0]trideca-1(13),8,10-trien-7-yl]ethenyl]pyrimidin-4-amine.
| Compound Name | 2-cyclohexyl-6-ethyl-N-[1-[10-[3-(2-fluoropropan-2-yl)phenyl]-2-methyl-2,7,9-triazabicyclo[6.5.0]trideca-1(13),8,10-trien-7-yl]ethenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137401013 |
| Molecular Formula | C34H45FN6 |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 2-cyclohexyl-6-ethyl-N-[1-[10-[3-(2-fluoropropan-2-yl)phenyl]-2-methyl-2,7,9-triazabicyclo[6.5.0]trideca-1(13),8,10-trien-7-yl]ethenyl]pyrimidin-4-amine |
| SMILES | C=C(Nc1cc(CC)nc(C2CCCCC2)n1)N1CCCCN(C)C2=CCC=C(c3cccc(C(C)(C)F)c3)N=C21 |
| InChI | InChI=1S/C34H45FN6/c1-6-28-23-31(39-32(37-28)25-14-8-7-9-15-25)36-24(2)41-21-11-10-20-40(5)30-19-13-18-29(38-33(30)41)26-16-12-17-27(22-26)34(3,4)35/h12,16-19,22-23,25H,2,6-11,13-15,20-21H2,1,3-5H3,(H,36,37,39) |
| InChIKey | UYTZDDAKMIVBLL-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |