C28H34F3N5S — CID 137401071
2-amino-N-[1-(1,3-benzothiazol-2-ylamino)ethenyl]-N-pentyl-N'-[(Z)-1-[3-(trifluoromethyl)phenyl]but-1-enyl]propanimidamide (PubChem CID 137401071) has the molecular formula C28H34F3N5S and a molecular weight of 529.68 g/mol. Its IUPAC name is 2-amino-N-[1-(1,3-benzothiazol-2-ylamino)ethenyl]-N-pentyl-N'-[(Z)-1-[3-(trifluoromethyl)phenyl]but-1-enyl]propanimidamide.
| Compound Name | 2-amino-N-[1-(1,3-benzothiazol-2-ylamino)ethenyl]-N-pentyl-N'-[(Z)-1-[3-(trifluoromethyl)phenyl]but-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 137401071 |
| Molecular Formula | C28H34F3N5S |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-amino-N-[1-(1,3-benzothiazol-2-ylamino)ethenyl]-N-pentyl-N'-[(Z)-1-[3-(trifluoromethyl)phenyl]but-1-enyl]propanimidamide |
| SMILES | C=C(Nc1nc2ccccc2s1)N(CCCCC)/C(=N/C(=C\CC)c1cccc(C(F)(F)F)c1)C(C)N |
| InChI | InChI=1S/C28H34F3N5S/c1-5-7-10-17-36(20(4)33-27-35-24-15-8-9-16-25(24)37-27)26(19(3)32)34-23(12-6-2)21-13-11-14-22(18-21)28(29,30)31/h8-9,11-16,18-19H,4-7,10,17,32H2,1-3H3,(H,33,35)/b23-12-,34-26+ |
| InChIKey | BWLRGXFZZQOEIH-YLEXWRJESA-N |
| XLogP | 7.89 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|