C25H23N5O2 — CID 137401094
2-(1-benzofuran-5-yl)-1-[2-(cyclohexylamino)pyrimidin-4-yl]benzimidazol-5-ol (PubChem CID 137401094) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-(1-benzofuran-5-yl)-1-[2-(cyclohexylamino)pyrimidin-4-yl]benzimidazol-5-ol.
| Compound Name | 2-(1-benzofuran-5-yl)-1-[2-(cyclohexylamino)pyrimidin-4-yl]benzimidazol-5-ol |
|---|---|
| PubChem CID | 137401094 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-(1-benzofuran-5-yl)-1-[2-(cyclohexylamino)pyrimidin-4-yl]benzimidazol-5-ol |
| SMILES | Oc1ccc2c(c1)nc(-c1ccc3occc3c1)n2-c1ccnc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C25H23N5O2/c31-19-7-8-21-20(15-19)28-24(17-6-9-22-16(14-17)11-13-32-22)30(21)23-10-12-26-25(29-23)27-18-4-2-1-3-5-18/h6-15,18,31H,1-5H2,(H,26,27,29) |
| InChIKey | XRBJMCNHHJGXOG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |