C9H18N2 — CID 137401131
(1E,4Z)-1-N'-ethyl-2-methylhexa-1,4-diene-1,1-diamine (PubChem CID 137401131) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (1E,4Z)-1-N'-ethyl-2-methylhexa-1,4-diene-1,1-diamine.
| Compound Name | (1E,4Z)-1-N'-ethyl-2-methylhexa-1,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 137401131 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (1E,4Z)-1-N'-ethyl-2-methylhexa-1,4-diene-1,1-diamine |
| SMILES | C/C=C\C/C(C)=C(\N)NCC |
| InChI | InChI=1S/C9H18N2/c1-4-6-7-8(3)9(10)11-5-2/h4,6,11H,5,7,10H2,1-3H3/b6-4-,9-8+ |
| InChIKey | AHUZDGVYXDHRFS-LJWGDIBWSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|